C18H24IN7OS — CID 109423429
3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423429) has the molecular formula C18H24IN7OS and a molecular weight of 513.41 g/mol. Its IUPAC name is 3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423429 |
| Molecular Formula | C18H24IN7OS |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccc(OC)cc2)n[nH]1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C18H23N7OS.HI/c1-12-21-14(11-27-12)10-25(3)18(19-2)20-9-16-22-17(24-23-16)13-5-7-15(26-4)8-6-13;/h5-8,11H,9-10H2,1-4H3,(H,19,20)(H,22,23,24);1H |
| InChIKey | YFJPFOKFUIDABZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|