C21H26IN5O2S — CID 109422975
3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109422975) has the molecular formula C21H26IN5O2S and a molecular weight of 539.44 g/mol. Its IUPAC name is 3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109422975 |
| Molecular Formula | C21H26IN5O2S |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 3-[[6-(4-methoxyphenoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(Oc2ccc(OC)cc2)nc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C21H25N5O2S.HI/c1-15-25-17(14-29-15)13-26(3)21(22-2)24-12-16-5-10-20(23-11-16)28-19-8-6-18(27-4)7-9-19;/h5-11,14H,12-13H2,1-4H3,(H,22,24);1H |
| InChIKey | QDPNCBLRSGJWLW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|