C17H23F2IN4O2S — CID 109423929
3-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423929) has the molecular formula C17H23F2IN4O2S and a molecular weight of 512.36 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423929 |
| Molecular Formula | C17H23F2IN4O2S |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 3-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)cc1OC(F)F)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C17H22F2N4O2S.HI/c1-11-22-13(10-26-11)9-23(3)17(20-2)21-8-12-5-6-14(24-4)7-15(12)25-16(18)19;/h5-7,10,16H,8-9H2,1-4H3,(H,20,21);1H |
| InChIKey | KJPFPFWAFJEEDW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|