C20H30ClIN4OS — CID 109454599
3-[2-(2-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109454599) has the molecular formula C20H30ClIN4OS and a molecular weight of 536.91 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(2-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109454599 |
| Molecular Formula | C20H30ClIN4OS |
| Molecular Weight | 536.91 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 3-[2-(2-chlorophenyl)-2-methylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(C)(C)c1ccccc1Cl)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H29ClN4OS.HI/c1-14(26-6)18-24-15(12-27-18)11-25(5)19(22-4)23-13-20(2,3)16-9-7-8-10-17(16)21;/h7-10,12,14H,11,13H2,1-6H3,(H,22,23);1H |
| InChIKey | ILMFUIJRTWVCAE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|