C21H33IN4O2S — CID 109454933
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]guanidine;hydroiodide (PubChem CID 109454933) has the molecular formula C21H33IN4O2S and a molecular weight of 532.49 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109454933 |
| Molecular Formula | C21H33IN4O2S |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1OC(C)(C)C)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C21H32N4O2S.HI/c1-15(26-7)19-24-17(14-28-19)13-25(6)20(22-5)23-12-16-10-8-9-11-18(16)27-21(2,3)4;/h8-11,14-15H,12-13H2,1-7H3,(H,22,23);1H |
| InChIKey | XBCLXAMMAIFAPM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|