C19H26Cl2N4OS — CID 109455008
3-[2-(2,6-dichlorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109455008) has the molecular formula C19H26Cl2N4OS and a molecular weight of 429.42 g/mol. Its IUPAC name is 3-[2-(2,6-dichlorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(2,6-dichlorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109455008 |
| Molecular Formula | C19H26Cl2N4OS |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 3-[2-(2,6-dichlorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC(C)c1c(Cl)cccc1Cl)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C19H26Cl2N4OS/c1-12(17-15(20)7-6-8-16(17)21)9-23-19(22-3)25(4)10-14-11-27-18(24-14)13(2)26-5/h6-8,11-13H,9-10H2,1-5H3,(H,22,23) |
| InChIKey | OHFYXGIRSIYTSB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|