C19H27F2IN4OS — CID 109456971
3-[2-(3,4-difluorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109456971) has the molecular formula C19H27F2IN4OS and a molecular weight of 524.42 g/mol. Its IUPAC name is 3-[2-(3,4-difluorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(3,4-difluorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456971 |
| Molecular Formula | C19H27F2IN4OS |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 3-[2-(3,4-difluorophenyl)propyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(C)c1ccc(F)c(F)c1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C19H26F2N4OS.HI/c1-12(14-6-7-16(20)17(21)8-14)9-23-19(22-3)25(4)10-15-11-27-18(24-15)13(2)26-5;/h6-8,11-13H,9-10H2,1-5H3,(H,22,23);1H |
| InChIKey | FZWNMPMHHZPVAB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|