C20H26ClIN6O2S — CID 109455309
3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109455309) has the molecular formula C20H26ClIN6O2S and a molecular weight of 576.89 g/mol. Its IUPAC name is 3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109455309 |
| Molecular Formula | C20H26ClIN6O2S |
| Molecular Weight | 576.89 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | 3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nc(-c2cccc(Cl)c2)no1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H25ClN6O2S.HI/c1-13(28-4)19-24-16(12-30-19)11-27(3)20(22-2)23-9-8-17-25-18(26-29-17)14-6-5-7-15(21)10-14;/h5-7,10,12-13H,8-9,11H2,1-4H3,(H,22,23);1H |
| InChIKey | WRBJEBPUYQCTDY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|