C17H25ClIN5OS — CID 109455281
3-[2-(6-chloro-3-pyridinyl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109455281) has the molecular formula C17H25ClIN5OS and a molecular weight of 509.85 g/mol. Its IUPAC name is 3-[2-(6-chloro-3-pyridinyl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(6-chloro-3-pyridinyl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109455281 |
| Molecular Formula | C17H25ClIN5OS |
| Molecular Weight | 509.85 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | 3-[2-(6-chloro-3-pyridinyl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(Cl)nc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C17H24ClN5OS.HI/c1-12(24-4)16-22-14(11-25-16)10-23(3)17(19-2)20-8-7-13-5-6-15(18)21-9-13;/h5-6,9,11-12H,7-8,10H2,1-4H3,(H,19,20);1H |
| InChIKey | WOWAYVWTGWXGCS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|