C20H29F2IN4O3S — CID 109456723
3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109456723) has the molecular formula C20H29F2IN4O3S and a molecular weight of 570.44 g/mol. Its IUPAC name is 3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456723 |
| Molecular Formula | C20H29F2IN4O3S |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 3-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC(F)F)c1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H28F2N4O3S.HI/c1-13(27-4)18-25-15(12-30-18)11-26(3)20(23-2)24-9-8-14-6-7-16(28-5)17(10-14)29-19(21)22;/h6-7,10,12-13,19H,8-9,11H2,1-5H3,(H,23,24);1H |
| InChIKey | YGBFDNHNUHFJGX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|