C21H39IN4O3S — CID 109456675
tert-butyl 7-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 109456675) has the molecular formula C21H39IN4O3S and a molecular weight of 554.54 g/mol. Its IUPAC name is tert-butyl 7-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | tert-butyl 7-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 109456675 |
| Molecular Formula | C21H39IN4O3S |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | tert-butyl 7-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCCCC(=O)OC(C)(C)C)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C21H38N4O3S.HI/c1-16(27-7)19-24-17(15-29-19)14-25(6)20(22-5)23-13-11-9-8-10-12-18(26)28-21(2,3)4;/h15-16H,8-14H2,1-7H3,(H,22,23);1H |
| InChIKey | FNAZHVWQNBCYCL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|