C17H32IN5O2S — CID 109454557
N-butan-2-yl-3-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 109454557) has the molecular formula C17H32IN5O2S and a molecular weight of 497.45 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109454557 |
| Molecular Formula | C17H32IN5O2S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | N-butan-2-yl-3-[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C17H31N5O2S.HI/c1-7-12(2)20-15(23)8-9-19-17(18-4)22(5)10-14-11-25-16(21-14)13(3)24-6;/h11-13H,7-10H2,1-6H3,(H,18,19)(H,20,23);1H |
| InChIKey | JIWDZUYKTZOHEY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|