C21H33IN6O2S — CID 109457015
1-[4-[[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 109457015) has the molecular formula C21H33IN6O2S and a molecular weight of 560.51 g/mol. Its IUPAC name is 1-[4-[[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 109457015 |
| Molecular Formula | C21H33IN6O2S |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 1-[4-[[[N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(NC(=O)NC(C)C)cc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C21H32N6O2S.HI/c1-14(2)24-21(28)26-17-9-7-16(8-10-17)11-23-20(22-4)27(5)12-18-13-30-19(25-18)15(3)29-6;/h7-10,13-15H,11-12H2,1-6H3,(H,22,23)(H2,24,26,28);1H |
| InChIKey | BKDYXYRLSWEPHT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|