C23H37N5O2S — CID 109457066
3-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109457066) has the molecular formula C23H37N5O2S and a molecular weight of 447.65 g/mol. Its IUPAC name is 3-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109457066 |
| Molecular Formula | C23H37N5O2S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 3-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | CCN(CC)CCOc1ccc(CN/C(=N/C)N(C)Cc2csc(C(C)OC)n2)cc1 |
| InChI | InChI=1S/C23H37N5O2S/c1-7-28(8-2)13-14-30-21-11-9-19(10-12-21)15-25-23(24-4)27(5)16-20-17-31-22(26-20)18(3)29-6/h9-12,17-18H,7-8,13-16H2,1-6H3,(H,24,25) |
| InChIKey | LCGSSXCMTCUPFY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|