C24H38IN5OS — CID 109454949
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[4-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 109454949) has the molecular formula C24H38IN5OS and a molecular weight of 571.57 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[4-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[4-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109454949 |
| Molecular Formula | C24H38IN5OS |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[[4-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CN2CCCCC2C)cc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C24H37N5OS.HI/c1-18-8-6-7-13-29(18)15-21-11-9-20(10-12-21)14-26-24(25-3)28(4)16-22-17-31-23(27-22)19(2)30-5;/h9-12,17-19H,6-8,13-16H2,1-5H3,(H,25,26);1H |
| InChIKey | SASJELSIZUWQHC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|