C22H30F2N4OS — CID 109456742
3-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109456742) has the molecular formula C22H30F2N4OS and a molecular weight of 436.57 g/mol. Its IUPAC name is 3-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109456742 |
| Molecular Formula | C22H30F2N4OS |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC1(c2c(F)cccc2F)CCCC1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C22H30F2N4OS/c1-15(29-4)20-27-16(13-30-20)12-28(3)21(25-2)26-14-22(10-5-6-11-22)19-17(23)8-7-9-18(19)24/h7-9,13,15H,5-6,10-12,14H2,1-4H3,(H,25,26) |
| InChIKey | IXHVMPVBHOOQOT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|