C23H38IN5OS — CID 109457059
3-[2-(diethylamino)-3-phenylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109457059) has the molecular formula C23H38IN5OS and a molecular weight of 559.56 g/mol. Its IUPAC name is 3-[2-(diethylamino)-3-phenylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(diethylamino)-3-phenylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109457059 |
| Molecular Formula | C23H38IN5OS |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 3-[2-(diethylamino)-3-phenylpropyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCN(CC)C(CN/C(=N/C)N(C)Cc1csc(C(C)OC)n1)Cc1ccccc1.I |
| InChI | InChI=1S/C23H37N5OS.HI/c1-7-28(8-2)21(14-19-12-10-9-11-13-19)15-25-23(24-4)27(5)16-20-17-30-22(26-20)18(3)29-6;/h9-13,17-18,21H,7-8,14-16H2,1-6H3,(H,24,25);1H |
| InChIKey | GFBASYXFGJJPNO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|