C21H31IN4OS — CID 109455137
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 109455137) has the molecular formula C21H31IN4OS and a molecular weight of 514.48 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109455137 |
| Molecular Formula | C21H31IN4OS |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CC1c1ccccc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C21H30N4OS.HI/c1-5-22-21(23-12-17-11-19(17)16-9-7-6-8-10-16)25(3)13-18-14-27-20(24-18)15(2)26-4;/h6-10,14-15,17,19H,5,11-13H2,1-4H3,(H,22,23);1H |
| InChIKey | TZAOSKIRLYWOIR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|