C20H32IN5OS2 — CID 109456641
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide (PubChem CID 109456641) has the molecular formula C20H32IN5OS2 and a molecular weight of 549.55 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456641 |
| Molecular Formula | C20H32IN5OS2 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCc2sccc2C1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H31N5OS2.HI/c1-5-21-20(24(3)13-17-14-28-19(23-17)15(2)26-4)22-8-10-25-9-6-18-16(12-25)7-11-27-18;/h7,11,14-15H,5-6,8-10,12-13H2,1-4H3,(H,21,22);1H |
| InChIKey | MCJNMJAVKMZZCA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|