C22H32IN5O2S — CID 109455565
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide (PubChem CID 109455565) has the molecular formula C22H32IN5O2S and a molecular weight of 557.50 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109455565 |
| Molecular Formula | C22H32IN5O2S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2ccccc2C1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C22H31N5O2S.HI/c1-5-23-22(26(3)14-19-15-30-21(25-19)16(2)29-4)24-12-20(28)27-11-10-17-8-6-7-9-18(17)13-27;/h6-9,15-16H,5,10-14H2,1-4H3,(H,23,24);1H |
| InChIKey | VHCRKGNCODBFLI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|