C20H39IN6OS — CID 109455615
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide (PubChem CID 109455615) has the molecular formula C20H39IN6OS and a molecular weight of 538.54 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109455615 |
| Molecular Formula | C20H39IN6OS |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCN(C)CC1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H38N6OS.HI/c1-6-21-20(22-9-7-8-10-26-13-11-24(3)12-14-26)25(4)15-18-16-28-19(23-18)17(2)27-5;/h16-17H,6-15H2,1-5H3,(H,21,22);1H |
| InChIKey | LZCAUCDXJCYKAF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|