C16H29IN4OS2 — CID 109455233
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide (PubChem CID 109455233) has the molecular formula C16H29IN4OS2 and a molecular weight of 484.47 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109455233 |
| Molecular Formula | C16H29IN4OS2 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C=CCSCC/N=C(\NCC)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C16H28N4OS2.HI/c1-6-9-22-10-8-18-16(17-7-2)20(4)11-14-12-23-15(19-14)13(3)21-5;/h6,12-13H,1,7-11H2,2-5H3,(H,17,18);1H |
| InChIKey | CPLNOLXDKXFHIQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|