C19H35N5OS — CID 109456566
2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine (PubChem CID 109456566) has the molecular formula C19H35N5OS and a molecular weight of 381.59 g/mol. Its IUPAC name is 2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109456566 |
| Molecular Formula | C19H35N5OS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CCN(C(C)C)C1CC1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C19H35N5OS/c1-7-20-19(21-10-11-24(14(2)3)17-8-9-17)23(5)12-16-13-26-18(22-16)15(4)25-6/h13-15,17H,7-12H2,1-6H3,(H,20,21) |
| InChIKey | DYWFFTMLCGYHOC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|