C20H30N4O3S2 — CID 109457108
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine (PubChem CID 109457108) has the molecular formula C20H30N4O3S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109457108 |
| Molecular Formula | C20H30N4O3S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccc(S(C)(=O)=O)cc1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C20H30N4O3S2/c1-6-21-20(24(3)13-17-14-28-19(23-17)15(2)27-4)22-12-11-16-7-9-18(10-8-16)29(5,25)26/h7-10,14-15H,6,11-13H2,1-5H3,(H,21,22) |
| InChIKey | ADMOQCVNSOBSBI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|