C22H32IN5OS — CID 109456253
3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 109456253) has the molecular formula C22H32IN5OS and a molecular weight of 541.50 g/mol. Its IUPAC name is 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109456253 |
| Molecular Formula | C22H32IN5OS |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-2-[2-(2-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c(C)[nH]c2ccccc12)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C22H31N5OS.HI/c1-6-23-22(27(4)13-17-14-29-21(26-17)16(3)28-5)24-12-11-18-15(2)25-20-10-8-7-9-19(18)20;/h7-10,14,16,25H,6,11-13H2,1-5H3,(H,23,24);1H |
| InChIKey | DFEOTWPIJSELSP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|