C18H28IN5O — CID 109383509
3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383509) has the molecular formula C18H28IN5O and a molecular weight of 457.36 g/mol. Its IUPAC name is 3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383509 |
| Molecular Formula | C18H28IN5O |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cn2ccccc2n1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H27N5O.HI/c1-3-19-18(22(2)12-15-8-11-24-14-15)20-9-7-16-13-23-10-5-4-6-17(23)21-16;/h4-6,10,13,15H,3,7-9,11-12,14H2,1-2H3,(H,19,20);1H |
| InChIKey | UECKRDNHVHBOSJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|