C16H18ClN5S — CID 111294505
1-[(2-chlorophenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,2-dimethylguanidine (PubChem CID 111294505) has the molecular formula C16H18ClN5S and a molecular weight of 347.88 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,2-dimethylguanidine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111294505 |
| Molecular Formula | C16H18ClN5S |
| Molecular Weight | 347.88 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCc1cn2ccsc2n1)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN5S/c1-18-15(21(2)10-12-5-3-4-6-14(12)17)19-9-13-11-22-7-8-23-16(22)20-13/h3-8,11H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | FDSKRZYRVFRYGH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.88 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|