C18H24ClIN4OS — CID 111294512
N-[3-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111294512) has the molecular formula C18H24ClIN4OS and a molecular weight of 506.84 g/mol. Its IUPAC name is N-[3-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111294512 |
| Molecular Formula | C18H24ClIN4OS |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | N-[3-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1cccs1)N(C)Cc1ccccc1Cl.I |
| InChI | InChI=1S/C18H23ClN4OS.HI/c1-20-18(23(2)13-14-7-3-4-8-15(14)19)22-11-6-10-21-17(24)16-9-5-12-25-16;/h3-5,7-9,12H,6,10-11,13H2,1-2H3,(H,20,22)(H,21,24);1H |
| InChIKey | CFARKCOVXGDJSH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|