C13H22IN3O — CID 111215798
3-ethyl-2-[(2-methoxyphenyl)methyl]-1,1-dimethylguanidine;hydroiodide (PubChem CID 111215798) has the molecular formula C13H22IN3O and a molecular weight of 363.24 g/mol. Its IUPAC name is 3-ethyl-2-[(2-methoxyphenyl)methyl]-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[(2-methoxyphenyl)methyl]-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111215798 |
| Molecular Formula | C13H22IN3O |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-ethyl-2-[(2-methoxyphenyl)methyl]-1,1-dimethylguanidine;hydroiodide |
| SMILES | CCN/C(=N/Cc1ccccc1OC)N(C)C.I |
| InChI | InChI=1S/C13H21N3O.HI/c1-5-14-13(16(2)3)15-10-11-8-6-7-9-12(11)17-4;/h6-9H,5,10H2,1-4H3,(H,14,15);1H |
| InChIKey | UJWKLKHGGFVMAV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|