C21H31IN4O3S — CID 111282008
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111282008) has the molecular formula C21H31IN4O3S and a molecular weight of 546.48 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111282008 |
| Molecular Formula | C21H31IN4O3S |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C21H30N4O3S.HI/c1-6-22-21(25(4)16-18-12-7-9-13-19(18)28-5)23-15-17-11-8-10-14-20(17)29(26,27)24(2)3;/h7-14H,6,15-16H2,1-5H3,(H,22,23);1H |
| InChIKey | IIVVWXQQIHEVJJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|