C20H25IN4O — CID 111281310
2-[(4-cyanophenyl)methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111281310) has the molecular formula C20H25IN4O and a molecular weight of 464.35 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[(4-cyanophenyl)methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111281310 |
| Molecular Formula | C20H25IN4O |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[(4-cyanophenyl)methyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C#N)cc1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C20H24N4O.HI/c1-4-22-20(23-14-17-11-9-16(13-21)10-12-17)24(2)15-18-7-5-6-8-19(18)25-3;/h5-12H,4,14-15H2,1-3H3,(H,22,23);1H |
| InChIKey | ZHFNNVUIUWDIQH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|