C22H32IN3O4 — CID 111368110
1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111368110) has the molecular formula C22H32IN3O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111368110 |
| Molecular Formula | C22H32IN3O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)N(C)Cc1cc(OC)c(OC)cc1C.I |
| InChI | InChI=1S/C22H31N3O4.HI/c1-7-23-22(24-13-16-9-8-10-18(27-4)21(16)26)25(3)14-17-12-20(29-6)19(28-5)11-15(17)2;/h8-12,26H,7,13-14H2,1-6H3,(H,23,24);1H |
| InChIKey | TYTMJJROXRRVET-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|