C18H22F2IN5O2S — CID 109495426
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide (PubChem CID 109495426) has the molecular formula C18H22F2IN5O2S and a molecular weight of 537.37 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109495426 |
| Molecular Formula | C18H22F2IN5O2S |
| Molecular Weight | 537.37 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C18H21F2N5O2S.HI/c1-2-21-17(22-9-13-11-25-7-8-28-18(25)24-13)23-10-15(26)12-3-5-14(6-4-12)27-16(19)20;/h3-8,11,15-16,26H,2,9-10H2,1H3,(H2,21,22,23);1H |
| InChIKey | KTYFWDFEVYDKAJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|