C19H24FN5S — CID 111624834
1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine (PubChem CID 111624834) has the molecular formula C19H24FN5S and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111624834 |
| Molecular Formula | C19H24FN5S |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C19H24FN5S/c1-4-21-17(22-11-16-12-25-8-9-26-18(25)24-16)23-13-19(2,3)14-6-5-7-15(20)10-14/h5-10,12H,4,11,13H2,1-3H3,(H2,21,22,23) |
| InChIKey | DDDSUPAKRXVNSH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|