C24H33N3O5 — CID 111872259
2-(1,3-benzodioxol-5-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111872259) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111872259 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | COCCOCCCN/C(=N\Cc1ccc2c(c1)OCO2)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C24H33N3O5/c1-18(2)32-21-8-6-20(7-9-21)27-24(25-11-4-12-29-14-13-28-3)26-16-19-5-10-22-23(15-19)31-17-30-22/h5-10,15,18H,4,11-14,16-17H2,1-3H3,(H2,25,26,27) |
| InChIKey | KJBHTZIAVRVXIY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|