C24H33IN4O4 — CID 111866639
3-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111866639) has the molecular formula C24H33IN4O4 and a molecular weight of 568.46 g/mol. Its IUPAC name is 3-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111866639 |
| Molecular Formula | C24H33IN4O4 |
| Molecular Weight | 568.46 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 3-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(=N/CC(C)(C)C(N)=O)NCCc2ccc3c(c2)OCO3)cc1.I |
| InChI | InChI=1S/C24H32N4O4.HI/c1-16(2)32-19-8-6-18(7-9-19)28-23(27-14-24(3,4)22(25)29)26-12-11-17-5-10-20-21(13-17)31-15-30-20;/h5-10,13,16H,11-12,14-15H2,1-4H3,(H2,25,29)(H2,26,27,28);1H |
| InChIKey | XOYVLAPLWWEZPK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|