C17H28IN3O2S — CID 111609679
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111609679) has the molecular formula C17H28IN3O2S and a molecular weight of 465.40 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111609679 |
| Molecular Formula | C17H28IN3O2S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C17H27N3O2S.HI/c1-5-18-16(20-11-17(2,3)23-4)19-9-8-13-6-7-14-15(10-13)22-12-21-14;/h6-7,10H,5,8-9,11-12H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | VABNEKBZEJPZJS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|