C16H23N3O2 — CID 111380131
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine (PubChem CID 111380131) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111380131 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CC1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H23N3O2/c1-2-17-16(19-10-13-3-4-13)18-8-7-12-5-6-14-15(9-12)21-11-20-14/h5-6,9,13H,2-4,7-8,10-11H2,1H3,(H2,17,18,19) |
| InChIKey | ZENNWCDSYCSCAC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|