C22H29IN4O3 — CID 111767562
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111767562) has the molecular formula C22H29IN4O3 and a molecular weight of 524.40 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111767562 |
| Molecular Formula | C22H29IN4O3 |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(OCC2CC2)c1)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C22H28N4O3.HI/c1-2-23-22(25-10-7-16-5-6-19-20(11-16)29-15-28-19)26-13-18-8-9-24-21(12-18)27-14-17-3-4-17;/h5-6,8-9,11-12,17H,2-4,7,10,13-15H2,1H3,(H2,23,25,26);1H |
| InChIKey | DFBWLKVGGKRHRZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|