C19H31IN4O4S — CID 111379400
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111379400) has the molecular formula C19H31IN4O4S and a molecular weight of 538.45 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111379400 |
| Molecular Formula | C19H31IN4O4S |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C19H30N4O4S.HI/c1-3-20-19(22-13-16-7-10-23(11-8-16)28(2,24)25)21-9-6-15-4-5-17-18(12-15)27-14-26-17;/h4-5,12,16H,3,6-11,13-14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | OLQHOIPVPCITEV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|