C18H29FN4O2S — CID 111394971
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 111394971) has the molecular formula C18H29FN4O2S and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111394971 |
| Molecular Formula | C18H29FN4O2S |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C18H29FN4O2S/c1-3-20-18(21-10-7-15-5-4-6-17(19)13-15)22-14-16-8-11-23(12-9-16)26(2,24)25/h4-6,13,16H,3,7-12,14H2,1-2H3,(H2,20,21,22) |
| InChIKey | MJLXLXOSMKTZQJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|