C21H34FN5O2S — CID 109395273
1-ethyl-3-[1-(3-fluorophenyl)piperidin-3-yl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 109395273) has the molecular formula C21H34FN5O2S and a molecular weight of 439.60 g/mol. Its IUPAC name is 1-ethyl-3-[1-(3-fluorophenyl)piperidin-3-yl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[1-(3-fluorophenyl)piperidin-3-yl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109395273 |
| Molecular Formula | C21H34FN5O2S |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 1-ethyl-3-[1-(3-fluorophenyl)piperidin-3-yl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NC1CCCN(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C21H34FN5O2S/c1-3-23-21(24-15-17-9-12-27(13-10-17)30(2,28)29)25-19-7-5-11-26(16-19)20-8-4-6-18(22)14-20/h4,6,8,14,17,19H,3,5,7,9-13,15-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | ZLGJAHDCNKPCSH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|