C18H29F2IN4O3S — CID 109395881
1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109395881) has the molecular formula C18H29F2IN4O3S and a molecular weight of 546.42 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109395881 |
| Molecular Formula | C18H29F2IN4O3S |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NCCOc1ccc(F)cc1F.I |
| InChI | InChI=1S/C18H28F2N4O3S.HI/c1-3-21-18(22-8-11-27-17-5-4-15(19)12-16(17)20)23-13-14-6-9-24(10-7-14)28(2,25)26;/h4-5,12,14H,3,6-11,13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | MLNOTPDJXBWHSL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|