C15H23F2N3O2 — CID 111547865
1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine (PubChem CID 111547865) has the molecular formula C15H23F2N3O2 and a molecular weight of 315.36 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 111547865 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine |
| SMILES | CCN/C(=N\CCCOC)NCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C15H23F2N3O2/c1-3-18-15(19-7-4-9-21-2)20-8-10-22-14-6-5-12(16)11-13(14)17/h5-6,11H,3-4,7-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | JFPIIZSCHCIZHE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|