C15H24F2IN3O — CID 110974740
1-[2-(3,5-difluorophenyl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide (PubChem CID 110974740) has the molecular formula C15H24F2IN3O and a molecular weight of 427.28 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110974740 |
| Molecular Formula | C15H24F2IN3O |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC)NCCc1cc(F)cc(F)c1.I |
| InChI | InChI=1S/C15H23F2N3O.HI/c1-3-18-15(19-6-4-8-21-2)20-7-5-12-9-13(16)11-14(17)10-12;/h9-11H,3-8H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | OJAWJXMVNNPSSF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|