C16H26F2IN3O3 — CID 111787304
1-[2-(2,4-difluorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111787304) has the molecular formula C16H26F2IN3O3 and a molecular weight of 473.30 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111787304 |
| Molecular Formula | C16H26F2IN3O3 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCCOC)NCCOc1ccc(F)cc1F.I |
| InChI | InChI=1S/C16H25F2N3O3.HI/c1-19-16(20-6-3-8-23-11-10-22-2)21-7-9-24-15-5-4-13(17)12-14(15)18;/h4-5,12H,3,6-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | SFWNZXMNEPYLLU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|