C17H27F2N3O2 — CID 111783119
1-(3-butoxypropyl)-3-[2-(2,4-difluorophenoxy)ethyl]-2-methylguanidine (PubChem CID 111783119) has the molecular formula C17H27F2N3O2 and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[2-(2,4-difluorophenoxy)ethyl]-2-methylguanidine.
| Compound Name | 1-(3-butoxypropyl)-3-[2-(2,4-difluorophenoxy)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111783119 |
| Molecular Formula | C17H27F2N3O2 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[2-(2,4-difluorophenoxy)ethyl]-2-methylguanidine |
| SMILES | CCCCOCCCN/C(=N\C)NCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C17H27F2N3O2/c1-3-4-10-23-11-5-8-21-17(20-2)22-9-12-24-16-7-6-14(18)13-15(16)19/h6-7,13H,3-5,8-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | RQUWGCRBMVWABX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|