C21H36N4O3S — CID 111402837
1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine (PubChem CID 111402837) has the molecular formula C21H36N4O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111402837 |
| Molecular Formula | C21H36N4O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NCCCOC(C)c1ccccc1 |
| InChI | InChI=1S/C21H36N4O3S/c1-4-22-21(24-17-19-11-14-25(15-12-19)29(3,26)27)23-13-8-16-28-18(2)20-9-6-5-7-10-20/h5-7,9-10,18-19H,4,8,11-17H2,1-3H3,(H2,22,23,24) |
| InChIKey | FOLQNUVTKBQEJM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|