C25H35N3O2 — CID 111620902
1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(2-phenyloxolan-3-yl)methyl]guanidine (PubChem CID 111620902) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(2-phenyloxolan-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(2-phenyloxolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111620902 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(2-phenyloxolan-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCOC1c1ccccc1)NCCCOC(C)c1ccccc1 |
| InChI | InChI=1S/C25H35N3O2/c1-3-26-25(27-16-10-17-29-20(2)21-11-6-4-7-12-21)28-19-23-15-18-30-24(23)22-13-8-5-9-14-22/h4-9,11-14,20,23-24H,3,10,15-19H2,1-2H3,(H2,26,27,28) |
| InChIKey | RCVHNZVFUZWERK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|