C20H34IN3O — CID 111620919
1-ethyl-3-hexyl-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111620919) has the molecular formula C20H34IN3O and a molecular weight of 459.42 g/mol. Its IUPAC name is 1-ethyl-3-hexyl-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-hexyl-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111620919 |
| Molecular Formula | C20H34IN3O |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-ethyl-3-hexyl-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCCCCN/C(=N/CC1CCOC1c1ccccc1)NCC.I |
| InChI | InChI=1S/C20H33N3O.HI/c1-3-5-6-10-14-22-20(21-4-2)23-16-18-13-15-24-19(18)17-11-8-7-9-12-17;/h7-9,11-12,18-19H,3-6,10,13-16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | CYSUPHSADYHRCE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|